About 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one
4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one (PubChem CID 53021518) has the molecular formula C27H28N6O2
and a molecular weight of 468.56 g/mol. Its IUPAC name is 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 53021518 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one |
| SMILES | CN(C)c1cccc(C(=O)N2CCN(c3nc4cccnc4n(Cc4ccccc4)c3=O)CC2)c1 |
| InChI | InChI=1S/C27H28N6O2/c1-30(2)22-11-6-10-21(18-22)26(34)32-16-14-31(15-17-32)25-27(35)33(19-20-8-4-3-5-9-20)24-23(29-25)12-7-13-28-24/h3-13,18H,14-17,19H2,1-2H3 |
| InChIKey | YOBBVFUEHKYTKY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one (CID 53021518) is 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one is CN(C)c1cccc(C(=O)N2CCN(c3nc4cccnc4n(Cc4ccccc4)c3=O)CC2)c1.
What is the InChIKey of 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one?
The InChIKey is YOBBVFUEHKYTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N6O2/c1-30(2)22-11-6-10-21(18-22)26(34)32-16-14-31(15-17-32)25-27(35)33(19-20-8-4-3-5-9-20)24-23(29-25)12-7-13-28-24/h3-13,18H,14-17,19H2,1-2H3.
What are the key properties of 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one?
4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one has a molecular weight of 468.56 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-[4-[3-(dimethylamino)benzoyl]piperazin-1-yl]pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 53021518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).