About 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine
6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine (PubChem CID 53021985) has the molecular formula C21H19N5O
and a molecular weight of 357.42 g/mol. Its IUPAC name is 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine |
| PubChem CID | 53021985 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine |
| SMILES | Cc1ccc(-c2noc(-c3ccc(NCCc4ccccc4)nn3)n2)cc1 |
| InChI | InChI=1S/C21H19N5O/c1-15-7-9-17(10-8-15)20-23-21(27-26-20)18-11-12-19(25-24-18)22-14-13-16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,22,25) |
| InChIKey | LKXYLAQKJYZGPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine?
The IUPAC name of 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine (CID 53021985) is 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine.
What is the SMILES notation for 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine?
The canonical SMILES for 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine is Cc1ccc(-c2noc(-c3ccc(NCCc4ccccc4)nn3)n2)cc1.
What is the InChIKey of 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine?
The InChIKey is LKXYLAQKJYZGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5O/c1-15-7-9-17(10-8-15)20-23-21(27-26-20)18-11-12-19(25-24-18)22-14-13-16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,22,25).
What are the key properties of 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine?
6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine has a molecular weight of 357.42 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-phenylethyl)pyridazin-3-amine is sourced from PubChem (CID 53021985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).