C26H22N6O3S — CID 5302205
4-amino-8-(3-nitrophenyl)-10-oxo-17-thia-5,15,19-triazahexacyclo[17.2.2.02,18.03,16.06,15.09,14]tricosa-2(18),3(16),4,6,9(14)-pentaene-7-carbonitrile (PubChem CID 5302205) has the molecular formula C26H22N6O3S and a molecular weight of 498.57 g/mol. Its IUPAC name is 4-amino-8-(3-nitrophenyl)-10-oxo-17-thia-5,15,19-triazahexacyclo[17.2.2.02,18.03,16.06,15.09,14]tricosa-2(18),3(16),4,6,9(14)-pentaene-7-carbonitrile.
| Compound Name | 4-amino-8-(3-nitrophenyl)-10-oxo-17-thia-5,15,19-triazahexacyclo[17.2.2.02,18.03,16.06,15.09,14]tricosa-2(18),3(16),4,6,9(14)-pentaene-7-carbonitrile |
|---|---|
| PubChem CID | 5302205 |
| Molecular Formula | C26H22N6O3S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 4-amino-8-(3-nitrophenyl)-10-oxo-17-thia-5,15,19-triazahexacyclo[17.2.2.02,18.03,16.06,15.09,14]tricosa-2(18),3(16),4,6,9(14)-pentaene-7-carbonitrile |
| SMILES | N#CC1=C2N=C(N)c3c(sc4c3C3CCN4CC3)N2C2=C(C(=O)CCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22N6O3S/c27-12-16-19(14-3-1-4-15(11-14)32(34)35)21-17(5-2-6-18(21)33)31-24(16)29-23(28)22-20-13-7-9-30(10-8-13)25(20)36-26(22)31/h1,3-4,11,13,19H,2,5-10H2,(H2,28,29) |
| InChIKey | CKURAXPXBXCSIC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|