About 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide
9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide (PubChem CID 5302217) has the molecular formula C16H16ClN3O3S
and a molecular weight of 365.84 g/mol. Its IUPAC name is 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide.
Molecular Properties
| Compound Name | 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide |
| PubChem CID | 5302217 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc2c(=O)nc3ccccn3c2cc1Cl |
| InChI | InChI=1S/C16H16ClN3O3S/c1-3-19(4-2)24(22,23)14-9-11-13(10-12(14)17)20-8-6-5-7-15(20)18-16(11)21/h5-10H,3-4H2,1-2H3 |
| InChIKey | ZMZLVAJGUBHKML-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide?
The IUPAC name of 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide (CID 5302217) is 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide.
What is the SMILES notation for 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide?
The canonical SMILES for 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide is CCN(CC)S(=O)(=O)c1cc2c(=O)nc3ccccn3c2cc1Cl.
What is the InChIKey of 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide?
The InChIKey is ZMZLVAJGUBHKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN3O3S/c1-3-19(4-2)24(22,23)14-9-11-13(10-12(14)17)20-8-6-5-7-15(20)18-16(11)21/h5-10H,3-4H2,1-2H3.
What are the key properties of 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide?
9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide has a molecular weight of 365.84 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-N,N-diethyl-6-oxopyrido[1,2-a]quinazoline-8-sulfonamide is sourced from PubChem (CID 5302217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).