About N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide
N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 53022323) has the molecular formula C19H16N4OS
and a molecular weight of 348.43 g/mol. Its IUPAC name is N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide |
| PubChem CID | 53022323 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1nc2cccnc2n1Cc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C19H16N4OS/c24-19(16-9-5-11-25-16)21-12-17-22-15-8-4-10-20-18(15)23(17)13-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,21,24) |
| InChIKey | ZNTSFXAQDBACQA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide?
The IUPAC name of N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide (CID 53022323) is N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide?
The canonical SMILES for N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide is O=C(NCc1nc2cccnc2n1Cc1ccccc1)c1cccs1.
What is the InChIKey of N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide?
The InChIKey is ZNTSFXAQDBACQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4OS/c24-19(16-9-5-11-25-16)21-12-17-22-15-8-4-10-20-18(15)23(17)13-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,21,24).
What are the key properties of N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide?
N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide has a molecular weight of 348.43 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]thiophene-2-carboxamide is sourced from PubChem (CID 53022323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).