C20H17N5O4S — CID 53022372
N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 53022372) has the molecular formula C20H17N5O4S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 53022372 |
| Molecular Formula | C20H17N5O4S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[(3-benzylimidazo[4,5-b]pyridin-2-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCc2nc3cccnc3n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H17N5O4S/c26-25(27)16-8-4-9-17(12-16)30(28,29)22-13-19-23-18-10-5-11-21-20(18)24(19)14-15-6-2-1-3-7-15/h1-12,22H,13-14H2 |
| InChIKey | UAHJUGVRMOIDKI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|