C19H20N2O3S — CID 53024504
methyl 6-[2-oxo-2-(3-phenylpropylamino)ethyl]thieno[2,3-b]pyrrole-5-carboxylate (PubChem CID 53024504) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is methyl 6-[2-oxo-2-(3-phenylpropylamino)ethyl]thieno[2,3-b]pyrrole-5-carboxylate.
| Compound Name | methyl 6-[2-oxo-2-(3-phenylpropylamino)ethyl]thieno[2,3-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 53024504 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methyl 6-[2-oxo-2-(3-phenylpropylamino)ethyl]thieno[2,3-b]pyrrole-5-carboxylate |
| SMILES | COC(=O)c1cc2ccsc2n1CC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-24-19(23)16-12-15-9-11-25-18(15)21(16)13-17(22)20-10-5-8-14-6-3-2-4-7-14/h2-4,6-7,9,11-12H,5,8,10,13H2,1H3,(H,20,22) |
| InChIKey | HBNHJBPAQAEUJT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|