C26H21FN4O2 — CID 53026088
N-benzyl-2-(3-benzyl-8-fluoro-4-oxopyrimido[5,4-b]indol-5-yl)acetamide (PubChem CID 53026088) has the molecular formula C26H21FN4O2 and a molecular weight of 440.48 g/mol. Its IUPAC name is N-benzyl-2-(3-benzyl-8-fluoro-4-oxopyrimido[5,4-b]indol-5-yl)acetamide.
| Compound Name | N-benzyl-2-(3-benzyl-8-fluoro-4-oxopyrimido[5,4-b]indol-5-yl)acetamide |
|---|---|
| PubChem CID | 53026088 |
| Molecular Formula | C26H21FN4O2 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-benzyl-2-(3-benzyl-8-fluoro-4-oxopyrimido[5,4-b]indol-5-yl)acetamide |
| SMILES | O=C(Cn1c2ccc(F)cc2c2ncn(Cc3ccccc3)c(=O)c21)NCc1ccccc1 |
| InChI | InChI=1S/C26H21FN4O2/c27-20-11-12-22-21(13-20)24-25(26(33)30(17-29-24)15-19-9-5-2-6-10-19)31(22)16-23(32)28-14-18-7-3-1-4-8-18/h1-13,17H,14-16H2,(H,28,32) |
| InChIKey | YQAFRRLSDDMDSH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |