About 4,7-dichloro-1H-imidazo[4,5-d]pyridazine
4,7-dichloro-1H-imidazo[4,5-d]pyridazine (PubChem CID 5302825) has the molecular formula C5H2Cl2N4
and a molecular weight of 189.01 g/mol. Its IUPAC name is 4,7-dichloro-1H-imidazo[4,5-d]pyridazine.
Molecular Properties
| Compound Name | 4,7-dichloro-1H-imidazo[4,5-d]pyridazine |
| PubChem CID | 5302825 |
| Molecular Formula | C5H2Cl2N4 |
| Molecular Weight | 189.01 g/mol |
| Exact Mass | 187.97 |
| IUPAC Name | 4,7-dichloro-1H-imidazo[4,5-d]pyridazine |
| SMILES | Clc1nnc(Cl)c2[nH]cnc12 |
| InChI | InChI=1S/C5H2Cl2N4/c6-4-2-3(9-1-8-2)5(7)11-10-4/h1H,(H,8,9) |
| InChIKey | KDFRQLMTRRFLKG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.01 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dichloro-1H-imidazo[4,5-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dichloro-1H-imidazo[4,5-d]pyridazine?
The IUPAC name of 4,7-dichloro-1H-imidazo[4,5-d]pyridazine (CID 5302825) is 4,7-dichloro-1H-imidazo[4,5-d]pyridazine.
What is the SMILES notation for 4,7-dichloro-1H-imidazo[4,5-d]pyridazine?
The canonical SMILES for 4,7-dichloro-1H-imidazo[4,5-d]pyridazine is Clc1nnc(Cl)c2[nH]cnc12.
What is the InChIKey of 4,7-dichloro-1H-imidazo[4,5-d]pyridazine?
The InChIKey is KDFRQLMTRRFLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2N4/c6-4-2-3(9-1-8-2)5(7)11-10-4/h1H,(H,8,9).
What are the key properties of 4,7-dichloro-1H-imidazo[4,5-d]pyridazine?
4,7-dichloro-1H-imidazo[4,5-d]pyridazine has a molecular weight of 189.01 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dichloro-1H-imidazo[4,5-d]pyridazine is sourced from PubChem (CID 5302825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).