C28H27ClN4OS — CID 53028862
7-(4-chlorophenyl)-14-methyl-N-(3-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 53028862) has the molecular formula C28H27ClN4OS and a molecular weight of 503.07 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-14-methyl-N-(3-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | 7-(4-chlorophenyl)-14-methyl-N-(3-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 53028862 |
| Molecular Formula | C28H27ClN4OS |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 7-(4-chlorophenyl)-14-methyl-N-(3-methylphenyl)-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2Cc3c(sc4c3CCN(C)C4)-n3cccc3C2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H27ClN4OS/c1-18-5-3-6-21(15-18)30-28(34)33-16-23-22-12-14-31(2)17-25(22)35-27(23)32-13-4-7-24(32)26(33)19-8-10-20(29)11-9-19/h3-11,13,15,26H,12,14,16-17H2,1-2H3,(H,30,34) |
| InChIKey | PPGLHCXLAOPWOS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |