C30H32N4OS — CID 53028923
N-(2,5-dimethylphenyl)-14-ethyl-7-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide (PubChem CID 53028923) has the molecular formula C30H32N4OS and a molecular weight of 496.68 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-14-ethyl-7-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-14-ethyl-7-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 53028923 |
| Molecular Formula | C30H32N4OS |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-(2,5-dimethylphenyl)-14-ethyl-7-phenyl-17-thia-2,8,14-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),3,5,11(16)-tetraene-8-carboxamide |
| SMILES | CCN1CCc2c(sc3c2CN(C(=O)Nc2cc(C)ccc2C)C(c2ccccc2)c2cccn2-3)C1 |
| InChI | InChI=1S/C30H32N4OS/c1-4-32-16-14-23-24-18-34(30(35)31-25-17-20(2)12-13-21(25)3)28(22-9-6-5-7-10-22)26-11-8-15-33(26)29(24)36-27(23)19-32/h5-13,15,17,28H,4,14,16,18-19H2,1-3H3,(H,31,35) |
| InChIKey | VERIJJMLOKIZQF-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |