C15H36Si3 — CID 530290
1,5-bis(trimethylsilyl)hex-5-en-3-yl-trimethylsilane (PubChem CID 530290) has the molecular formula C15H36Si3 and a molecular weight of 300.71 g/mol. Its IUPAC name is 1,5-bis(trimethylsilyl)hex-5-en-3-yl-trimethylsilane.
| Compound Name | 1,5-bis(trimethylsilyl)hex-5-en-3-yl-trimethylsilane |
|---|---|
| PubChem CID | 530290 |
| Molecular Formula | C15H36Si3 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1,5-bis(trimethylsilyl)hex-5-en-3-yl-trimethylsilane |
| SMILES | C=C(CC(CC[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H36Si3/c1-14(17(5,6)7)13-15(18(8,9)10)11-12-16(2,3)4/h15H,1,11-13H2,2-10H3 |
| InChIKey | PLHFHQKKOKLMGA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|