C25H26N4O3S — CID 53030682
2-[4-[(4-methylphenyl)methyl]-2,3-dioxopyrido[2,3-b]pyrazin-1-yl]-N-(1-thiophen-2-ylbutyl)acetamide (PubChem CID 53030682) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopyrido[2,3-b]pyrazin-1-yl]-N-(1-thiophen-2-ylbutyl)acetamide.
| Compound Name | 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopyrido[2,3-b]pyrazin-1-yl]-N-(1-thiophen-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 53030682 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopyrido[2,3-b]pyrazin-1-yl]-N-(1-thiophen-2-ylbutyl)acetamide |
| SMILES | CCCC(NC(=O)Cn1c(=O)c(=O)n(Cc2ccc(C)cc2)c2ncccc21)c1cccs1 |
| InChI | InChI=1S/C25H26N4O3S/c1-3-6-19(21-8-5-14-33-21)27-22(30)16-28-20-7-4-13-26-23(20)29(25(32)24(28)31)15-18-11-9-17(2)10-12-18/h4-5,7-14,19H,3,6,15-16H2,1-2H3,(H,27,30) |
| InChIKey | LYFNRKQVBSEARK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|