C22H23FN2O6 — CID 5303147
(4Z)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethylamino)ethyl]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 5303147) has the molecular formula C22H23FN2O6 and a molecular weight of 430.43 g/mol. Its IUPAC name is (4Z)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethylamino)ethyl]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethylamino)ethyl]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5303147 |
| Molecular Formula | C22H23FN2O6 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (4Z)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethylamino)ethyl]-5-(4-hydroxy-3-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(/O)c3ccc(F)cc3)C(=O)C(=O)N2CCNCCO)ccc1O |
| InChI | InChI=1S/C22H23FN2O6/c1-31-17-12-14(4-7-16(17)27)19-18(20(28)13-2-5-15(23)6-3-13)21(29)22(30)25(19)10-8-24-9-11-26/h2-7,12,19,24,26-28H,8-11H2,1H3/b20-18- |
| InChIKey | ZJAYVVQJXJNMJW-ZZEZOPTASA-N |
| XLogP | 1.54 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|