C18H21N3O6 — CID 5303253
1,3-dimethyl-5-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 5303253) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3-dimethyl-5-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 5303253 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1,3-dimethyl-5-(3,4,5-trimethoxyphenyl)-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | COc1cc(C2CC(=O)Nc3c2c(=O)n(C)c(=O)n3C)cc(OC)c1OC |
| InChI | InChI=1S/C18H21N3O6/c1-20-16-14(17(23)21(2)18(20)24)10(8-13(22)19-16)9-6-11(25-3)15(27-5)12(7-9)26-4/h6-7,10H,8H2,1-5H3,(H,19,22) |
| InChIKey | PTZNYFANTHLYMJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |