About 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one
6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one (PubChem CID 53033622) has the molecular formula C17H13ClN4O2
and a molecular weight of 340.77 g/mol. Its IUPAC name is 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one |
| PubChem CID | 53033622 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one |
| SMILES | CCn1c(=O)[nH]c2cc(-c3noc(-c4ccccc4Cl)n3)ccc21 |
| InChI | InChI=1S/C17H13ClN4O2/c1-2-22-14-8-7-10(9-13(14)19-17(22)23)15-20-16(24-21-15)11-5-3-4-6-12(11)18/h3-9H,2H2,1H3,(H,19,23) |
| InChIKey | AOEVEXRMUHRZMF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one?
The IUPAC name of 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one (CID 53033622) is 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one.
What is the SMILES notation for 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one?
The canonical SMILES for 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one is CCn1c(=O)[nH]c2cc(-c3noc(-c4ccccc4Cl)n3)ccc21.
What is the InChIKey of 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one?
The InChIKey is AOEVEXRMUHRZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O2/c1-2-22-14-8-7-10(9-13(14)19-17(22)23)15-20-16(24-21-15)11-5-3-4-6-12(11)18/h3-9H,2H2,1H3,(H,19,23).
What are the key properties of 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one?
6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one has a molecular weight of 340.77 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-(2-chlorophenyl)-1,2,4-oxadiazol-3-yl]-3-ethyl-1H-benzimidazol-2-one is sourced from PubChem (CID 53033622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).