About 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone
2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone (PubChem CID 53033960) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone |
| PubChem CID | 53033960 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone |
| SMILES | C=CCN1CCN(C(=O)CC2CCCC2)c2cccnc21 |
| InChI | InChI=1S/C17H23N3O/c1-2-10-19-11-12-20(15-8-5-9-18-17(15)19)16(21)13-14-6-3-4-7-14/h2,5,8-9,14H,1,3-4,6-7,10-13H2 |
| InChIKey | GYBRDJXXPAHYGX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone?
The IUPAC name of 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone (CID 53033960) is 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone.
What is the SMILES notation for 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone?
The canonical SMILES for 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone is C=CCN1CCN(C(=O)CC2CCCC2)c2cccnc21.
What is the InChIKey of 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone?
The InChIKey is GYBRDJXXPAHYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-2-10-19-11-12-20(15-8-5-9-18-17(15)19)16(21)13-14-6-3-4-7-14/h2,5,8-9,14H,1,3-4,6-7,10-13H2.
What are the key properties of 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone?
2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone has a molecular weight of 285.39 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1-(4-prop-2-enyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)ethanone is sourced from PubChem (CID 53033960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).