About 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine
3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine (PubChem CID 53034325) has the molecular formula C19H15ClFN5S
and a molecular weight of 399.88 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine.
Molecular Properties
| Compound Name | 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine |
| PubChem CID | 53034325 |
| Molecular Formula | C19H15ClFN5S |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine |
| SMILES | Cc1ccc(C)c(-c2csc(-c3nnn(-c4ccc(F)c(Cl)c4)c3N)n2)c1 |
| InChI | InChI=1S/C19H15ClFN5S/c1-10-3-4-11(2)13(7-10)16-9-27-19(23-16)17-18(22)26(25-24-17)12-5-6-15(21)14(20)8-12/h3-9H,22H2,1-2H3 |
| InChIKey | IIQGNXBGGJKOLS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine?
The IUPAC name of 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine (CID 53034325) is 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine.
What is the SMILES notation for 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine?
The canonical SMILES for 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine is Cc1ccc(C)c(-c2csc(-c3nnn(-c4ccc(F)c(Cl)c4)c3N)n2)c1.
What is the InChIKey of 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine?
The InChIKey is IIQGNXBGGJKOLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClFN5S/c1-10-3-4-11(2)13(7-10)16-9-27-19(23-16)17-18(22)26(25-24-17)12-5-6-15(21)14(20)8-12/h3-9H,22H2,1-2H3.
What are the key properties of 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine?
3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine has a molecular weight of 399.88 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-4-fluorophenyl)-5-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]triazol-4-amine is sourced from PubChem (CID 53034325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).