C15H16FN3O4 — CID 5303475
ethyl 2-[3-[[2-(4-fluorophenoxy)acetyl]amino]pyrazol-1-yl]acetate (PubChem CID 5303475) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is ethyl 2-[3-[[2-(4-fluorophenoxy)acetyl]amino]pyrazol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[[2-(4-fluorophenoxy)acetyl]amino]pyrazol-1-yl]acetate |
|---|---|
| PubChem CID | 5303475 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | ethyl 2-[3-[[2-(4-fluorophenoxy)acetyl]amino]pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1ccc(NC(=O)COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C15H16FN3O4/c1-2-22-15(21)9-19-8-7-13(18-19)17-14(20)10-23-12-5-3-11(16)4-6-12/h3-8H,2,9-10H2,1H3,(H,17,18,20) |
| InChIKey | YJDKTUGCLYBQOF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |