C18H17ClFNO3 — CID 53034757
(3-chlorophenyl)-[3-[(3-fluoro-4-methoxyphenyl)methoxy]azetidin-1-yl]methanone (PubChem CID 53034757) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is (3-chlorophenyl)-[3-[(3-fluoro-4-methoxyphenyl)methoxy]azetidin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[3-[(3-fluoro-4-methoxyphenyl)methoxy]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 53034757 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (3-chlorophenyl)-[3-[(3-fluoro-4-methoxyphenyl)methoxy]azetidin-1-yl]methanone |
| SMILES | COc1ccc(COC2CN(C(=O)c3cccc(Cl)c3)C2)cc1F |
| InChI | InChI=1S/C18H17ClFNO3/c1-23-17-6-5-12(7-16(17)20)11-24-15-9-21(10-15)18(22)13-3-2-4-14(19)8-13/h2-8,15H,9-11H2,1H3 |
| InChIKey | FFSBALTVTUMYFS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |