C21H26N4O — CID 53035074
(4-methylpiperidin-1-yl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]methanone (PubChem CID 53035074) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]methanone |
|---|---|
| PubChem CID | 53035074 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[4-(6-pyrrolidin-1-ylpyridazin-3-yl)phenyl]methanone |
| SMILES | CC1CCN(C(=O)c2ccc(-c3ccc(N4CCCC4)nn3)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O/c1-16-10-14-25(15-11-16)21(26)18-6-4-17(5-7-18)19-8-9-20(23-22-19)24-12-2-3-13-24/h4-9,16H,2-3,10-15H2,1H3 |
| InChIKey | FFGHXICSEGFKLR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |