C15H16N2OS2 — CID 5303533
4,5-bis(2,5-dimethylthiophen-3-yl)-1,3-dihydroimidazol-2-one (PubChem CID 5303533) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4,5-bis(2,5-dimethylthiophen-3-yl)-1,3-dihydroimidazol-2-one.
| Compound Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-1,3-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 5303533 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-1,3-dihydroimidazol-2-one |
| SMILES | Cc1cc(-c2[nH]c(=O)[nH]c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C15H16N2OS2/c1-7-5-11(9(3)19-7)13-14(17-15(18)16-13)12-6-8(2)20-10(12)4/h5-6H,1-4H3,(H2,16,17,18) |
| InChIKey | YNBXURMOBPOMFD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |