About N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide
N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide (PubChem CID 53035453) has the molecular formula C22H20FN3O2S2
and a molecular weight of 441.55 g/mol. Its IUPAC name is N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide.
Molecular Properties
| Compound Name | N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide |
| PubChem CID | 53035453 |
| Molecular Formula | C22H20FN3O2S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCc2ccccc2)cc(-c2nc(-c3ccc(F)cc3)cs2)n1C |
| InChI | InChI=1S/C22H20FN3O2S2/c1-15-21(30(27,28)24-13-16-6-4-3-5-7-16)12-20(26(15)2)22-25-19(14-29-22)17-8-10-18(23)11-9-17/h3-12,14,24H,13H2,1-2H3 |
| InChIKey | VIZYVFXZGRDHPW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide?
The IUPAC name of N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide (CID 53035453) is N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide.
What is the SMILES notation for N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide?
The canonical SMILES for N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide is Cc1c(S(=O)(=O)NCc2ccccc2)cc(-c2nc(-c3ccc(F)cc3)cs2)n1C.
What is the InChIKey of N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide?
The InChIKey is VIZYVFXZGRDHPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FN3O2S2/c1-15-21(30(27,28)24-13-16-6-4-3-5-7-16)12-20(26(15)2)22-25-19(14-29-22)17-8-10-18(23)11-9-17/h3-12,14,24H,13H2,1-2H3.
What are the key properties of N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide?
N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide has a molecular weight of 441.55 g/mol, XLogP of 4.74, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1,2-dimethylpyrrole-3-sulfonamide is sourced from PubChem (CID 53035453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).