C17H15FN4O4S — CID 5303695
N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5303695) has the molecular formula C17H15FN4O4S and a molecular weight of 390.40 g/mol. Its IUPAC name is N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5303695 |
| Molecular Formula | C17H15FN4O4S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[2-[[2-(4-fluorophenoxy)acetyl]amino]ethyl]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(COc1ccc(F)cc1)NCCNC(=O)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C17H15FN4O4S/c18-11-3-5-12(6-4-11)25-10-14(23)19-7-8-20-16(24)17-21-15(22-26-17)13-2-1-9-27-13/h1-6,9H,7-8,10H2,(H,19,23)(H,20,24) |
| InChIKey | DSBPFIORJYJUDE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|