C17H18N4O2 — CID 53037158
N-(3-methoxypropyl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine (PubChem CID 53037158) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine.
| Compound Name | N-(3-methoxypropyl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 53037158 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(3-methoxypropyl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyridin-2-amine |
| SMILES | COCCCNc1ccc(-c2nc(-c3ccccc3)no2)cn1 |
| InChI | InChI=1S/C17H18N4O2/c1-22-11-5-10-18-15-9-8-14(12-19-15)17-20-16(21-23-17)13-6-3-2-4-7-13/h2-4,6-9,12H,5,10-11H2,1H3,(H,18,19) |
| InChIKey | HJUSFINPXRDJML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|