C18H18N4O — CID 53037161
3-phenyl-5-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole (PubChem CID 53037161) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 3-phenyl-5-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole.
| Compound Name | 3-phenyl-5-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53037161 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-phenyl-5-(6-piperidin-1-yl-3-pyridinyl)-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2noc(-c3ccc(N4CCCCC4)nc3)n2)cc1 |
| InChI | InChI=1S/C18H18N4O/c1-3-7-14(8-4-1)17-20-18(23-21-17)15-9-10-16(19-13-15)22-11-5-2-6-12-22/h1,3-4,7-10,13H,2,5-6,11-12H2 |
| InChIKey | RESQIRWTPBFMPQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |