About N-(2-methylbutyl)deca-2,6,8-trienamide
N-(2-methylbutyl)deca-2,6,8-trienamide (PubChem CID 530392) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is N-(2-methylbutyl)deca-2,6,8-trienamide.
Molecular Properties
| Compound Name | N-(2-methylbutyl)deca-2,6,8-trienamide |
| PubChem CID | 530392 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-(2-methylbutyl)deca-2,6,8-trienamide |
| SMILES | CC=CC=CCCC=CC(=O)NCC(C)CC |
| InChI | InChI=1S/C15H25NO/c1-4-6-7-8-9-10-11-12-15(17)16-13-14(3)5-2/h4,6-8,11-12,14H,5,9-10,13H2,1-3H3,(H,16,17) |
| InChIKey | LWJDBUUOYULAFU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylbutyl)deca-2,6,8-trienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylbutyl)deca-2,6,8-trienamide?
The IUPAC name of N-(2-methylbutyl)deca-2,6,8-trienamide (CID 530392) is N-(2-methylbutyl)deca-2,6,8-trienamide.
What is the SMILES notation for N-(2-methylbutyl)deca-2,6,8-trienamide?
The canonical SMILES for N-(2-methylbutyl)deca-2,6,8-trienamide is CC=CC=CCCC=CC(=O)NCC(C)CC.
What is the InChIKey of N-(2-methylbutyl)deca-2,6,8-trienamide?
The InChIKey is LWJDBUUOYULAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-4-6-7-8-9-10-11-12-15(17)16-13-14(3)5-2/h4,6-8,11-12,14H,5,9-10,13H2,1-3H3,(H,16,17).
What are the key properties of N-(2-methylbutyl)deca-2,6,8-trienamide?
N-(2-methylbutyl)deca-2,6,8-trienamide has a molecular weight of 235.37 g/mol, XLogP of 3.62, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylbutyl)deca-2,6,8-trienamide is sourced from PubChem (CID 530392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).