About N-(2-methylpropyl)deca-2,6,8-trienamide
N-(2-methylpropyl)deca-2,6,8-trienamide (PubChem CID 530394) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is N-(2-methylpropyl)deca-2,6,8-trienamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)deca-2,6,8-trienamide |
| PubChem CID | 530394 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-(2-methylpropyl)deca-2,6,8-trienamide |
| SMILES | CC=CC=CCCC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-7,10-11,13H,8-9,12H2,1-3H3,(H,15,16) |
| InChIKey | BXOCHUWSGYYSFW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)deca-2,6,8-trienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)deca-2,6,8-trienamide?
The IUPAC name of N-(2-methylpropyl)deca-2,6,8-trienamide (CID 530394) is N-(2-methylpropyl)deca-2,6,8-trienamide.
What is the SMILES notation for N-(2-methylpropyl)deca-2,6,8-trienamide?
The canonical SMILES for N-(2-methylpropyl)deca-2,6,8-trienamide is CC=CC=CCCC=CC(=O)NCC(C)C.
What is the InChIKey of N-(2-methylpropyl)deca-2,6,8-trienamide?
The InChIKey is BXOCHUWSGYYSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-7,10-11,13H,8-9,12H2,1-3H3,(H,15,16).
What are the key properties of N-(2-methylpropyl)deca-2,6,8-trienamide?
N-(2-methylpropyl)deca-2,6,8-trienamide has a molecular weight of 221.34 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)deca-2,6,8-trienamide is sourced from PubChem (CID 530394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).