About 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine
3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine (PubChem CID 530404) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine.
Molecular Properties
| Compound Name | 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine |
| PubChem CID | 530404 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine |
| SMILES | Cc1cnc2c(n1)CCC2C |
| InChI | InChI=1S/C9H12N2/c1-6-3-4-8-9(6)10-5-7(2)11-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | CTFGVWCFSGCLHZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine?
The IUPAC name of 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine (CID 530404) is 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine.
What is the SMILES notation for 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine?
The canonical SMILES for 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine is Cc1cnc2c(n1)CCC2C.
What is the InChIKey of 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine?
The InChIKey is CTFGVWCFSGCLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-6-3-4-8-9(6)10-5-7(2)11-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine?
3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine has a molecular weight of 148.21 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-6,7-dihydro-5H-cyclopenta[b]pyrazine is sourced from PubChem (CID 530404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).