About 2-methylbutyl octanoate
2-methylbutyl octanoate (PubChem CID 530406) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-methylbutyl octanoate.
Molecular Properties
| Compound Name | 2-methylbutyl octanoate |
| PubChem CID | 530406 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2-methylbutyl octanoate |
| SMILES | CCCCCCCC(=O)OCC(C)CC |
| InChI | InChI=1S/C13H26O2/c1-4-6-7-8-9-10-13(14)15-11-12(3)5-2/h12H,4-11H2,1-3H3 |
| InChIKey | XZLBJDGPIWDVIJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl octanoate?
The IUPAC name of 2-methylbutyl octanoate (CID 530406) is 2-methylbutyl octanoate.
What is the SMILES notation for 2-methylbutyl octanoate?
The canonical SMILES for 2-methylbutyl octanoate is CCCCCCCC(=O)OCC(C)CC.
What is the InChIKey of 2-methylbutyl octanoate?
The InChIKey is XZLBJDGPIWDVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-4-6-7-8-9-10-13(14)15-11-12(3)5-2/h12H,4-11H2,1-3H3.
What are the key properties of 2-methylbutyl octanoate?
2-methylbutyl octanoate has a molecular weight of 214.35 g/mol, XLogP of 3.94, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl octanoate is sourced from PubChem (CID 530406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).