About (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone
(7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone (PubChem CID 53040943) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone |
| PubChem CID | 53040943 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCCCC2)nc2ccnn12 |
| InChI | InChI=1S/C16H22N4O/c1-16(2,3)13-11-12(18-14-7-8-17-20(13)14)15(21)19-9-5-4-6-10-19/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | FGYDMMIXHCULQM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone?
The IUPAC name of (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone (CID 53040943) is (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone is CC(C)(C)c1cc(C(=O)N2CCCCC2)nc2ccnn12.
What is the InChIKey of (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone?
The InChIKey is FGYDMMIXHCULQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-16(2,3)13-11-12(18-14-7-8-17-20(13)14)15(21)19-9-5-4-6-10-19/h7-8,11H,4-6,9-10H2,1-3H3.
What are the key properties of (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone?
(7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone has a molecular weight of 286.38 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butylpyrazolo[1,5-a]pyrimidin-5-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 53040943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).