About N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine
N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine (PubChem CID 5304114) has the molecular formula C22H21N6P
and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine |
| PubChem CID | 5304114 |
| Molecular Formula | C22H21N6P |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(N=P(Nc2ncccn2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C22H21N6P/c1-17-16-18(2)26-22(25-17)28-29(19-10-5-3-6-11-19,20-12-7-4-8-13-20)27-21-23-14-9-15-24-21/h3-16H,1-2H3,(H,23,24,27) |
| InChIKey | PZRBHRIDGWXIGJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine?
The IUPAC name of N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine (CID 5304114) is N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine.
What is the SMILES notation for N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine?
The canonical SMILES for N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine is Cc1cc(C)nc(N=P(Nc2ncccn2)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine?
The InChIKey is PZRBHRIDGWXIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N6P/c1-17-16-18(2)26-22(25-17)28-29(19-10-5-3-6-11-19,20-12-7-4-8-13-20)27-21-23-14-9-15-24-21/h3-16H,1-2H3,(H,23,24,27).
What are the key properties of N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine?
N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine has a molecular weight of 400.43 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethylpyrimidin-2-yl)imino-diphenyl-λ5-phosphanyl]pyrimidin-2-amine is sourced from PubChem (CID 5304114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).