C20H26N4O3S2 — CID 53041590
N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 53041590) has the molecular formula C20H26N4O3S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 53041590 |
| Molecular Formula | C20H26N4O3S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | CCc1nc(-c2cc(S(=O)(=O)Nc3ccc(N(CC)CC)cc3C)c(C)s2)no1 |
| InChI | InChI=1S/C20H26N4O3S2/c1-6-19-21-20(22-27-19)17-12-18(14(5)28-17)29(25,26)23-16-10-9-15(11-13(16)4)24(7-2)8-3/h9-12,23H,6-8H2,1-5H3 |
| InChIKey | GXXLFIANPSUWBT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|