C30H29N6P — CID 5304179
2-N,4-N,4-N-trimethyl-2-N-phenyl-6-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5-triazine-2,4-diamine (PubChem CID 5304179) has the molecular formula C30H29N6P and a molecular weight of 504.58 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-2-N-phenyl-6-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-2-N-phenyl-6-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5304179 |
| Molecular Formula | C30H29N6P |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-2-N-phenyl-6-[(triphenyl-λ5-phosphanylidene)amino]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)nc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C30H29N6P/c1-35(2)29-31-28(32-30(33-29)36(3)24-16-8-4-9-17-24)34-37(25-18-10-5-11-19-25,26-20-12-6-13-21-26)27-22-14-7-15-23-27/h4-23H,1-3H3 |
| InChIKey | LJSICVZDZYLPGE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|