About 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole
3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole (PubChem CID 5304183) has the molecular formula C15H12ClN3O
and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole |
| PubChem CID | 5304183 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole |
| SMILES | Cc1cc(C)c(-c2noc(-c3ccccc3)n2)c(Cl)n1 |
| InChI | InChI=1S/C15H12ClN3O/c1-9-8-10(2)17-13(16)12(9)14-18-15(20-19-14)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | SUDHKEVZJUEABG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole?
The IUPAC name of 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole (CID 5304183) is 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole.
What is the SMILES notation for 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole?
The canonical SMILES for 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole is Cc1cc(C)c(-c2noc(-c3ccccc3)n2)c(Cl)n1.
What is the InChIKey of 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole?
The InChIKey is SUDHKEVZJUEABG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O/c1-9-8-10(2)17-13(16)12(9)14-18-15(20-19-14)11-6-4-3-5-7-11/h3-8H,1-2H3.
What are the key properties of 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole?
3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole has a molecular weight of 285.73 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,6-dimethyl-3-pyridinyl)-5-phenyl-1,2,4-oxadiazole is sourced from PubChem (CID 5304183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).