C26H27N5O2 — CID 53041886
[4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]piperazin-1-yl]methanone (PubChem CID 53041886) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]piperazin-1-yl]methanone.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53041886 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(-c2ccc(N3CCN(C(=O)c4ccc(-n5c(C)ccc5C)cc4)CC3)cc2)no1 |
| InChI | InChI=1S/C26H27N5O2/c1-18-4-5-19(2)31(18)24-12-8-22(9-13-24)26(32)30-16-14-29(15-17-30)23-10-6-21(7-11-23)25-27-20(3)33-28-25/h4-13H,14-17H2,1-3H3 |
| InChIKey | YGNMFPRSJDVYHB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|