C13H15N3O4S — CID 53042642
4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonylmorpholine (PubChem CID 53042642) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 53042642 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]sulfonylmorpholine |
| SMILES | Cc1nc(-c2cccc(S(=O)(=O)N3CCOCC3)c2)no1 |
| InChI | InChI=1S/C13H15N3O4S/c1-10-14-13(15-20-10)11-3-2-4-12(9-11)21(17,18)16-5-7-19-8-6-16/h2-4,9H,5-8H2,1H3 |
| InChIKey | DOZYEMLJDBFFCO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |