C20H21N3O3S2 — CID 53042777
4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-sulfonamide (PubChem CID 53042777) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-sulfonamide.
| Compound Name | 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 53042777 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCc2ccccc21)c1cc(-c2noc(C3CCC3)n2)cs1 |
| InChI | InChI=1S/C20H21N3O3S2/c24-28(25,23-17-10-4-6-13-5-1-2-9-16(13)17)18-11-15(12-27-18)19-21-20(26-22-19)14-7-3-8-14/h1-2,5,9,11-12,14,17,23H,3-4,6-8,10H2 |
| InChIKey | GONLKDYMWZOKEO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |