C19H25N5O3S — CID 53043192
N-butyl-2-[1-ethyl-3-methyl-5,7-dioxo-6-(thiophen-2-ylmethyl)pyrazolo[4,5-d]pyrimidin-4-yl]acetamide (PubChem CID 53043192) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is N-butyl-2-[1-ethyl-3-methyl-5,7-dioxo-6-(thiophen-2-ylmethyl)pyrazolo[4,5-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-butyl-2-[1-ethyl-3-methyl-5,7-dioxo-6-(thiophen-2-ylmethyl)pyrazolo[4,5-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 53043192 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-butyl-2-[1-ethyl-3-methyl-5,7-dioxo-6-(thiophen-2-ylmethyl)pyrazolo[4,5-d]pyrimidin-4-yl]acetamide |
| SMILES | CCCCNC(=O)Cn1c(=O)n(Cc2cccs2)c(=O)c2c1c(C)nn2CC |
| InChI | InChI=1S/C19H25N5O3S/c1-4-6-9-20-15(25)12-22-16-13(3)21-24(5-2)17(16)18(26)23(19(22)27)11-14-8-7-10-28-14/h7-8,10H,4-6,9,11-12H2,1-3H3,(H,20,25) |
| InChIKey | USKGUAGHUNRFNK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|