C23H29N5O2 — CID 5304542
3-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methylamino]-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 5304542) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methylamino]-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methylamino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 5304542 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methylamino]-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)CC(NCC3CCN(c4nc(C)cc(C)n4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H29N5O2/c1-15-4-6-19(7-5-15)28-21(29)13-20(22(28)30)24-14-18-8-10-27(11-9-18)23-25-16(2)12-17(3)26-23/h4-7,12,18,20,24H,8-11,13-14H2,1-3H3 |
| InChIKey | ZMPQFRUYXHXLCJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|