C23H24N6O — CID 53046416
N-cyclopentyl-2-(5,7-diphenyl-7H-tetrazolo[1,5-a]pyrimidin-4-yl)acetamide (PubChem CID 53046416) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is N-cyclopentyl-2-(5,7-diphenyl-7H-tetrazolo[1,5-a]pyrimidin-4-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(5,7-diphenyl-7H-tetrazolo[1,5-a]pyrimidin-4-yl)acetamide |
|---|---|
| PubChem CID | 53046416 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-cyclopentyl-2-(5,7-diphenyl-7H-tetrazolo[1,5-a]pyrimidin-4-yl)acetamide |
| SMILES | O=C(CN1C(c2ccccc2)=CC(c2ccccc2)n2nnnc21)NC1CCCC1 |
| InChI | InChI=1S/C23H24N6O/c30-22(24-19-13-7-8-14-19)16-28-20(17-9-3-1-4-10-17)15-21(18-11-5-2-6-12-18)29-23(28)25-26-27-29/h1-6,9-12,15,19,21H,7-8,13-14,16H2,(H,24,30) |
| InChIKey | DWLSYGJPPVVRSR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |