About 1-adamantylmethyl 3-methylbenzoate
1-adamantylmethyl 3-methylbenzoate (PubChem CID 530473) has the molecular formula C19H24O2
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-adamantylmethyl 3-methylbenzoate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 3-methylbenzoate |
| PubChem CID | 530473 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-adamantylmethyl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H24O2/c1-13-3-2-4-17(5-13)18(20)21-12-19-9-14-6-15(10-19)8-16(7-14)11-19/h2-5,14-16H,6-12H2,1H3 |
| InChIKey | CWBMWEMUDGVFQF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantylmethyl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 3-methylbenzoate?
The IUPAC name of 1-adamantylmethyl 3-methylbenzoate (CID 530473) is 1-adamantylmethyl 3-methylbenzoate.
What is the SMILES notation for 1-adamantylmethyl 3-methylbenzoate?
The canonical SMILES for 1-adamantylmethyl 3-methylbenzoate is Cc1cccc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c1.
What is the InChIKey of 1-adamantylmethyl 3-methylbenzoate?
The InChIKey is CWBMWEMUDGVFQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O2/c1-13-3-2-4-17(5-13)18(20)21-12-19-9-14-6-15(10-19)8-16(7-14)11-19/h2-5,14-16H,6-12H2,1H3.
What are the key properties of 1-adamantylmethyl 3-methylbenzoate?
1-adamantylmethyl 3-methylbenzoate has a molecular weight of 284.40 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 3-methylbenzoate is sourced from PubChem (CID 530473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).