C22H18ClNO4S2 — CID 53047425
3-(4-chlorophenyl)sulfonyl-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 53047425) has the molecular formula C22H18ClNO4S2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 53047425 |
| Molecular Formula | C22H18ClNO4S2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-7-(4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C=CCOc1ccc(C2CC(=O)Nc3c(S(=O)(=O)c4ccc(Cl)cc4)csc32)cc1 |
| InChI | InChI=1S/C22H18ClNO4S2/c1-2-11-28-16-7-3-14(4-8-16)18-12-20(25)24-21-19(13-29-22(18)21)30(26,27)17-9-5-15(23)6-10-17/h2-10,13,18H,1,11-12H2,(H,24,25) |
| InChIKey | FQCCKGJYUSNSHR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|