C24H23NO6S2 — CID 53047463
3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one (PubChem CID 53047463) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 53047463 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-7-(3-methoxy-4-prop-2-enoxyphenyl)-6,7-dihydro-4H-thieno[3,2-b]pyridin-5-one |
| SMILES | C=CCOc1ccc(C2CC(=O)Nc3c(S(=O)(=O)c4ccc(OC)cc4)csc32)cc1OC |
| InChI | InChI=1S/C24H23NO6S2/c1-4-11-31-19-10-5-15(12-20(19)30-3)18-13-22(26)25-23-21(14-32-24(18)23)33(27,28)17-8-6-16(29-2)7-9-17/h4-10,12,14,18H,1,11,13H2,2-3H3,(H,25,26) |
| InChIKey | RHYAEKUVMNJRIE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|