C18H21ClN4O3 — CID 53050996
2-[2-(4-chlorophenyl)-5-oxo-6,7-dihydropyrazolo[1,5-a]pyrimidin-4-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 53050996) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-5-oxo-6,7-dihydropyrazolo[1,5-a]pyrimidin-4-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-5-oxo-6,7-dihydropyrazolo[1,5-a]pyrimidin-4-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 53050996 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-5-oxo-6,7-dihydropyrazolo[1,5-a]pyrimidin-4-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1C(=O)CCn2nc(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C18H21ClN4O3/c1-26-10-2-8-20-16(24)12-22-17-11-15(13-3-5-14(19)6-4-13)21-23(17)9-7-18(22)25/h3-6,11H,2,7-10,12H2,1H3,(H,20,24) |
| InChIKey | QDJKWUUTCBSUJD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|