About 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine
7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine (PubChem CID 5305172) has the molecular formula C7H4N6S
and a molecular weight of 204.22 g/mol. Its IUPAC name is 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine.
Molecular Properties
| Compound Name | 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine |
| PubChem CID | 5305172 |
| Molecular Formula | C7H4N6S |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine |
| SMILES | c1cc(-c2cnn3nnnc3n2)cs1 |
| InChI | InChI=1S/C7H4N6S/c1-2-14-4-5(1)6-3-8-13-7(9-6)10-11-12-13/h1-4H |
| InChIKey | NWTUSGYKCJCTQG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine?
The IUPAC name of 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine (CID 5305172) is 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine.
What is the SMILES notation for 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine?
The canonical SMILES for 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine is c1cc(-c2cnn3nnnc3n2)cs1.
What is the InChIKey of 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine?
The InChIKey is NWTUSGYKCJCTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N6S/c1-2-14-4-5(1)6-3-8-13-7(9-6)10-11-12-13/h1-4H.
What are the key properties of 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine?
7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine has a molecular weight of 204.22 g/mol, XLogP of 0.64, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-thiophen-3-yltetrazolo[1,5-b][1,2,4]triazine is sourced from PubChem (CID 5305172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).