C18H15N3O4 — CID 53051791
ethyl 3-[(5-pyridin-3-yl-1,2-oxazole-3-carbonyl)amino]benzoate (PubChem CID 53051791) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is ethyl 3-[(5-pyridin-3-yl-1,2-oxazole-3-carbonyl)amino]benzoate.
| Compound Name | ethyl 3-[(5-pyridin-3-yl-1,2-oxazole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 53051791 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | ethyl 3-[(5-pyridin-3-yl-1,2-oxazole-3-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2cc(-c3cccnc3)on2)c1 |
| InChI | InChI=1S/C18H15N3O4/c1-2-24-18(23)12-5-3-7-14(9-12)20-17(22)15-10-16(25-21-15)13-6-4-8-19-11-13/h3-11H,2H2,1H3,(H,20,22) |
| InChIKey | GBMURZABNDJRML-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |