C16H11FN4O6 — CID 53052610
1-[5-(3,5-dinitrophenyl)-2-(2-fluorophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 53052610) has the molecular formula C16H11FN4O6 and a molecular weight of 374.28 g/mol. Its IUPAC name is 1-[5-(3,5-dinitrophenyl)-2-(2-fluorophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[5-(3,5-dinitrophenyl)-2-(2-fluorophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 53052610 |
| Molecular Formula | C16H11FN4O6 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[5-(3,5-dinitrophenyl)-2-(2-fluorophenyl)-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)OC1c1ccccc1F |
| InChI | InChI=1S/C16H11FN4O6/c1-9(22)19-16(13-4-2-3-5-14(13)17)27-15(18-19)10-6-11(20(23)24)8-12(7-10)21(25)26/h2-8,16H,1H3 |
| InChIKey | GCIYVKVHXZJLBL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|