C23H30N2O3 — CID 53052961
4-[bis(2-methylpropyl)amino]-3-[(3-methylbenzoyl)amino]benzoic acid (PubChem CID 53052961) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)amino]-3-[(3-methylbenzoyl)amino]benzoic acid.
| Compound Name | 4-[bis(2-methylpropyl)amino]-3-[(3-methylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 53052961 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 4-[bis(2-methylpropyl)amino]-3-[(3-methylbenzoyl)amino]benzoic acid |
| SMILES | Cc1cccc(C(=O)Nc2cc(C(=O)O)ccc2N(CC(C)C)CC(C)C)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-15(2)13-25(14-16(3)4)21-10-9-19(23(27)28)12-20(21)24-22(26)18-8-6-7-17(5)11-18/h6-12,15-16H,13-14H2,1-5H3,(H,24,26)(H,27,28) |
| InChIKey | YNMRLOJVQLPARM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |