About 1-adamantylmethyl 4-(methanesulfonamido)benzoate
1-adamantylmethyl 4-(methanesulfonamido)benzoate (PubChem CID 5305298) has the molecular formula C19H25NO4S
and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-adamantylmethyl 4-(methanesulfonamido)benzoate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 4-(methanesulfonamido)benzoate |
| PubChem CID | 5305298 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-adamantylmethyl 4-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)OCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H25NO4S/c1-25(22,23)20-17-4-2-16(3-5-17)18(21)24-12-19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15,20H,6-12H2,1H3 |
| InChIKey | FEFWRHQRRDYDIO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-adamantylmethyl 4-(methanesulfonamido)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 4-(methanesulfonamido)benzoate?
The IUPAC name of 1-adamantylmethyl 4-(methanesulfonamido)benzoate (CID 5305298) is 1-adamantylmethyl 4-(methanesulfonamido)benzoate.
What is the SMILES notation for 1-adamantylmethyl 4-(methanesulfonamido)benzoate?
The canonical SMILES for 1-adamantylmethyl 4-(methanesulfonamido)benzoate is CS(=O)(=O)Nc1ccc(C(=O)OCC23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 1-adamantylmethyl 4-(methanesulfonamido)benzoate?
The InChIKey is FEFWRHQRRDYDIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO4S/c1-25(22,23)20-17-4-2-16(3-5-17)18(21)24-12-19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15,20H,6-12H2,1H3.
What are the key properties of 1-adamantylmethyl 4-(methanesulfonamido)benzoate?
1-adamantylmethyl 4-(methanesulfonamido)benzoate has a molecular weight of 363.48 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 4-(methanesulfonamido)benzoate is sourced from PubChem (CID 5305298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).